About 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile
3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile (PubChem CID 134959251) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile |
| PubChem CID | 134959251 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile |
| SMILES | CCCCC1C(C#N)=C(N)n2c(=O)c3ccccc3c(=O)n21 |
| InChI | InChI=1S/C16H16N4O2/c1-2-3-8-13-12(9-17)14(18)20-16(22)11-7-5-4-6-10(11)15(21)19(13)20/h4-7,13H,2-3,8,18H2,1H3 |
| InChIKey | ZLJRUFXGPKTGDE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile?
The IUPAC name of 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile (CID 134959251) is 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile.
What is the SMILES notation for 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile?
The canonical SMILES for 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile is CCCCC1C(C#N)=C(N)n2c(=O)c3ccccc3c(=O)n21.
What is the InChIKey of 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile?
The InChIKey is ZLJRUFXGPKTGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-2-3-8-13-12(9-17)14(18)20-16(22)11-7-5-4-6-10(11)15(21)19(13)20/h4-7,13H,2-3,8,18H2,1H3.
What are the key properties of 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile?
3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile has a molecular weight of 296.33 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-butyl-5,10-dioxo-1H-pyrazolo[1,2-b]phthalazine-2-carbonitrile is sourced from PubChem (CID 134959251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).