C18H24N2O4SSi — CID 134959271
N-[2-methoxy-5-(7-trimethylsilyl-1,3-dihydro-2-benzofuran-5-yl)-3-pyridinyl]methanesulfonamide (PubChem CID 134959271) has the molecular formula C18H24N2O4SSi and a molecular weight of 392.55 g/mol. Its IUPAC name is N-[2-methoxy-5-(7-trimethylsilyl-1,3-dihydro-2-benzofuran-5-yl)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[2-methoxy-5-(7-trimethylsilyl-1,3-dihydro-2-benzofuran-5-yl)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 134959271 |
| Molecular Formula | C18H24N2O4SSi |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[2-methoxy-5-(7-trimethylsilyl-1,3-dihydro-2-benzofuran-5-yl)-3-pyridinyl]methanesulfonamide |
| SMILES | COc1ncc(-c2cc3c(c([Si](C)(C)C)c2)COC3)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H24N2O4SSi/c1-23-18-16(20-25(2,21)22)7-13(9-19-18)12-6-14-10-24-11-15(14)17(8-12)26(3,4)5/h6-9,20H,10-11H2,1-5H3 |
| InChIKey | VYQDHPAEKIUVEL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|