C26H42O7 — CID 134959310
(1R,2R,3S,5S,8S,13S)-2,5,13-tris(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-10-one (PubChem CID 134959310) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is (1R,2R,3S,5S,8S,13S)-2,5,13-tris(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-10-one.
| Compound Name | (1R,2R,3S,5S,8S,13S)-2,5,13-tris(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-10-one |
|---|---|
| PubChem CID | 134959310 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (1R,2R,3S,5S,8S,13S)-2,5,13-tris(methoxymethoxy)-8,12,15,15-tetramethyl-4-methylidenetricyclo[9.3.1.03,8]pentadec-11-en-10-one |
| SMILES | C=C1[C@@H](OCOC)CC[C@@]2(C)CC(=O)C3=C(C)[C@@H](OCOC)C[C@@H]([C@@H](OCOC)[C@H]12)C3(C)C |
| InChI | InChI=1S/C26H42O7/c1-16-20(31-13-28-6)9-10-26(5)12-19(27)22-17(2)21(32-14-29-7)11-18(25(22,3)4)24(23(16)26)33-15-30-8/h18,20-21,23-24H,1,9-15H2,2-8H3/t18-,20-,21-,23-,24+,26-/m0/s1 |
| InChIKey | BAVRHVGLEUHQRK-JTELSQPYSA-N |
| XLogP | 4.26 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|