About 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene
2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene (PubChem CID 134959315) has the molecular formula C18H16O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene.
Molecular Properties
| Compound Name | 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene |
| PubChem CID | 134959315 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene |
| SMILES | COC1Cc2c(c3ccccc3c3ccccc23)C1 |
| InChI | InChI=1S/C18H16O/c1-19-12-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)18(17)11-12/h2-9,12H,10-11H2,1H3 |
| InChIKey | BINMSHSLEFQFKU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene?
The IUPAC name of 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene (CID 134959315) is 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene.
What is the SMILES notation for 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene?
The canonical SMILES for 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene is COC1Cc2c(c3ccccc3c3ccccc23)C1.
What is the InChIKey of 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene?
The InChIKey is BINMSHSLEFQFKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O/c1-19-12-10-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)18(17)11-12/h2-9,12H,10-11H2,1H3.
What are the key properties of 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene?
2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene has a molecular weight of 248.33 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3-dihydro-1H-cyclopenta[l]phenanthrene is sourced from PubChem (CID 134959315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).