C19H20F3NO4S — CID 134959363
tert-butyl N-[1-(benzenesulfonyl)-2-(2,4,5-trifluorophenyl)ethyl]carbamate (PubChem CID 134959363) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)-2-(2,4,5-trifluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)-2-(2,4,5-trifluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 134959363 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)-2-(2,4,5-trifluorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)c(F)cc1F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO4S/c1-19(2,3)27-18(24)23-17(28(25,26)13-7-5-4-6-8-13)10-12-9-15(21)16(22)11-14(12)20/h4-9,11,17H,10H2,1-3H3,(H,23,24) |
| InChIKey | WMBCVXFJULCMEG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|