C14H17Cl4NO2 — CID 134959385
2,2,2-trichloroethyl (2S,3R)-2-(6-chloro-3-pyridinyl)-3-methylhexanoate (PubChem CID 134959385) has the molecular formula C14H17Cl4NO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2S,3R)-2-(6-chloro-3-pyridinyl)-3-methylhexanoate.
| Compound Name | 2,2,2-trichloroethyl (2S,3R)-2-(6-chloro-3-pyridinyl)-3-methylhexanoate |
|---|---|
| PubChem CID | 134959385 |
| Molecular Formula | C14H17Cl4NO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2,2,2-trichloroethyl (2S,3R)-2-(6-chloro-3-pyridinyl)-3-methylhexanoate |
| SMILES | CCC[C@@H](C)[C@H](C(=O)OCC(Cl)(Cl)Cl)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H17Cl4NO2/c1-3-4-9(2)12(10-5-6-11(15)19-7-10)13(20)21-8-14(16,17)18/h5-7,9,12H,3-4,8H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | KLTHCZVUJWBTSF-SKDRFNHKSA-N |
| XLogP | 5.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|