C18H18F3NO4S — CID 134959483
ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 134959483) has the molecular formula C18H18F3NO4S and a molecular weight of 401.41 g/mol. Its IUPAC name is ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 134959483 |
| Molecular Formula | C18H18F3NO4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3NO4S/c1-3-26-17(23)16(13-5-4-6-14(11-13)18(19,20)21)22-27(24,25)15-9-7-12(2)8-10-15/h4-11,16,22H,3H2,1-2H3/t16-/m0/s1 |
| InChIKey | LMPBFSGUGMFUML-INIZCTEOSA-N |
| XLogP | 3.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |