C13H15FO3S — CID 134959490
ethyl 2-acetyl-2-fluoro-3-thiophen-2-ylpent-4-enoate (PubChem CID 134959490) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is ethyl 2-acetyl-2-fluoro-3-thiophen-2-ylpent-4-enoate.
| Compound Name | ethyl 2-acetyl-2-fluoro-3-thiophen-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 134959490 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | ethyl 2-acetyl-2-fluoro-3-thiophen-2-ylpent-4-enoate |
| SMILES | C=CC(c1cccs1)C(F)(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C13H15FO3S/c1-4-10(11-7-6-8-18-11)13(14,9(3)15)12(16)17-5-2/h4,6-8,10H,1,5H2,2-3H3 |
| InChIKey | MVHCUEPTWFVDLM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|