C30H26N2O4S2 — CID 134959494
1,3-dimethyl-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole (PubChem CID 134959494) has the molecular formula C30H26N2O4S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 1,3-dimethyl-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole.
| Compound Name | 1,3-dimethyl-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole |
|---|---|
| PubChem CID | 134959494 |
| Molecular Formula | C30H26N2O4S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 1,3-dimethyl-5,10-bis-(4-methylphenyl)sulfonylindolo[3,2-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3ccccc3c3c2c2cc(C)cc(C)c2n3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O4S2/c1-19-9-13-23(14-10-19)37(33,34)31-27-8-6-5-7-25(27)29-30(31)26-18-21(3)17-22(4)28(26)32(29)38(35,36)24-15-11-20(2)12-16-24/h5-18H,1-4H3 |
| InChIKey | APNODGLMJNTGFO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |