C31H56O3Si — CID 134959576
(1S,3R,4R,6S,7S,8E,11R,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-1,4-dimethyl-12-[(2R)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-ol (PubChem CID 134959576) has the molecular formula C31H56O3Si and a molecular weight of 504.87 g/mol. Its IUPAC name is (1S,3R,4R,6S,7S,8E,11R,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-1,4-dimethyl-12-[(2R)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-ol.
| Compound Name | (1S,3R,4R,6S,7S,8E,11R,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-1,4-dimethyl-12-[(2R)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-ol |
|---|---|
| PubChem CID | 134959576 |
| Molecular Formula | C31H56O3Si |
| Molecular Weight | 504.87 g/mol |
| Exact Mass | 504.40 |
| IUPAC Name | (1S,3R,4R,6S,7S,8E,11R,12S)-4-[tert-butyl(dimethyl)silyl]oxy-8-(hydroxymethyl)-1,4-dimethyl-12-[(2R)-6-methylhept-5-en-2-yl]tricyclo[9.3.0.03,7]tetradec-8-en-6-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CC[C@@]2(C)C[C@@H]3[C@@H](/C(CO)=C\C[C@H]12)[C@@H](O)C[C@@]3(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H56O3Si/c1-21(2)12-11-13-22(3)24-16-17-30(7)18-26-28(23(20-32)14-15-25(24)30)27(33)19-31(26,8)34-35(9,10)29(4,5)6/h12,14,22,24-28,32-33H,11,13,15-20H2,1-10H3/b23-14-/t22-,24+,25-,26-,27+,28-,30+,31-/m1/s1 |
| InChIKey | UCWOZBYQKCZMNG-XYXNSMLPSA-N |
| XLogP | 7.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.87 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|