C17H14BrNO — CID 134959800
(1R)-6-bromo-1-phenyl-1,3,4,9-tetrahydropyrano[3,4-b]indole (PubChem CID 134959800) has the molecular formula C17H14BrNO and a molecular weight of 328.21 g/mol. Its IUPAC name is (1R)-6-bromo-1-phenyl-1,3,4,9-tetrahydropyrano[3,4-b]indole.
| Compound Name | (1R)-6-bromo-1-phenyl-1,3,4,9-tetrahydropyrano[3,4-b]indole |
|---|---|
| PubChem CID | 134959800 |
| Molecular Formula | C17H14BrNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (1R)-6-bromo-1-phenyl-1,3,4,9-tetrahydropyrano[3,4-b]indole |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCO[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C17H14BrNO/c18-12-6-7-15-14(10-12)13-8-9-20-17(16(13)19-15)11-4-2-1-3-5-11/h1-7,10,17,19H,8-9H2/t17-/m1/s1 |
| InChIKey | GDXTWTCUKKZSFZ-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |