C15H18O5 — CID 134959826
dimethyl (3aR,8aR)-3,3a,5,6,7,8a-hexahydro-2H-cyclopenta[f][1]benzofuran-4,8-dicarboxylate (PubChem CID 134959826) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl (3aR,8aR)-3,3a,5,6,7,8a-hexahydro-2H-cyclopenta[f][1]benzofuran-4,8-dicarboxylate.
| Compound Name | dimethyl (3aR,8aR)-3,3a,5,6,7,8a-hexahydro-2H-cyclopenta[f][1]benzofuran-4,8-dicarboxylate |
|---|---|
| PubChem CID | 134959826 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl (3aR,8aR)-3,3a,5,6,7,8a-hexahydro-2H-cyclopenta[f][1]benzofuran-4,8-dicarboxylate |
| SMILES | COC(=O)C1=C2CCCC2=C(C(=O)OC)[C@@H]2OCC[C@H]12 |
| InChI | InChI=1S/C15H18O5/c1-18-14(16)11-8-4-3-5-9(8)12(15(17)19-2)13-10(11)6-7-20-13/h10,13H,3-7H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | LOQBZIKAOIOAOQ-ZWNOBZJWSA-N |
| XLogP | 1.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |