C19H21N — CID 134959840
(6aR)-6a,8,8-trimethyl-9,10-dihydro-7H-benzo[a]carbazole (PubChem CID 134959840) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is (6aR)-6a,8,8-trimethyl-9,10-dihydro-7H-benzo[a]carbazole.
| Compound Name | (6aR)-6a,8,8-trimethyl-9,10-dihydro-7H-benzo[a]carbazole |
|---|---|
| PubChem CID | 134959840 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (6aR)-6a,8,8-trimethyl-9,10-dihydro-7H-benzo[a]carbazole |
| SMILES | CC1(C)CCC2=C(C1)[C@@]1(C)C=Cc3ccccc3C1=N2 |
| InChI | InChI=1S/C19H21N/c1-18(2)10-9-16-15(12-18)19(3)11-8-13-6-4-5-7-14(13)17(19)20-16/h4-8,11H,9-10,12H2,1-3H3/t19-/m1/s1 |
| InChIKey | NJXMSVZTPZFFHI-LJQANCHMSA-N |
| XLogP | 4.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |