About [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate (PubChem CID 134959962) has the molecular formula C24H30O3S
and a molecular weight of 398.57 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate.
Molecular Properties
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate |
| PubChem CID | 134959962 |
| Molecular Formula | C24H30O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC1OC(=O)c1ccc([S@](=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H30O3S/c1-17(2)22-14-9-18(3)15-23(22)27-24(25)20-10-12-21(13-11-20)28(26)16-19-7-5-4-6-8-19/h4-8,10-13,17-18,22-23H,9,14-16H2,1-3H3/t18-,22+,23?,28-/m1/s1 |
| InChIKey | REBIASXFZPGBHE-GDVGIVFGSA-N |
| XLogP | 5.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate?
The IUPAC name of [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate (CID 134959962) is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate.
What is the SMILES notation for [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate?
The canonical SMILES for [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate is CC(C)[C@@H]1CC[C@@H](C)CC1OC(=O)c1ccc([S@](=O)Cc2ccccc2)cc1.
What is the InChIKey of [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate?
The InChIKey is REBIASXFZPGBHE-GDVGIVFGSA-N. The full InChI is InChI=1S/C24H30O3S/c1-17(2)22-14-9-18(3)15-23(22)27-24(25)20-10-12-21(13-11-20)28(26)16-19-7-5-4-6-8-19/h4-8,10-13,17-18,22-23H,9,14-16H2,1-3H3/t18-,22+,23?,28-/m1/s1.
What are the key properties of [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate?
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate has a molecular weight of 398.57 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-[(R)-benzylsulfinyl]benzoate is sourced from PubChem (CID 134959962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).