C35H38OSi — CID 134959963
3-methyl-2-[4-phenyl-2-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]benzaldehyde (PubChem CID 134959963) has the molecular formula C35H38OSi and a molecular weight of 502.77 g/mol. Its IUPAC name is 3-methyl-2-[4-phenyl-2-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]benzaldehyde.
| Compound Name | 3-methyl-2-[4-phenyl-2-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 134959963 |
| Molecular Formula | C35H38OSi |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 3-methyl-2-[4-phenyl-2-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]benzaldehyde |
| SMILES | Cc1cccc(C=O)c1-c1c(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C35H38OSi/c1-24(2)37(25(3)4,26(5)6)21-20-29-22-33(28-15-9-8-10-16-28)31-18-11-12-19-32(31)35(29)34-27(7)14-13-17-30(34)23-36/h8-19,22-26H,1-7H3 |
| InChIKey | IFVNPFMNDDOOAU-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|