C21H34F2O2Si — CID 134960091
(3R,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6,6-difluoro-1-phenylheptan-3-ol (PubChem CID 134960091) has the molecular formula C21H34F2O2Si and a molecular weight of 384.58 g/mol. Its IUPAC name is (3R,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6,6-difluoro-1-phenylheptan-3-ol.
| Compound Name | (3R,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6,6-difluoro-1-phenylheptan-3-ol |
|---|---|
| PubChem CID | 134960091 |
| Molecular Formula | C21H34F2O2Si |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (3R,4S)-7-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6,6-difluoro-1-phenylheptan-3-ol |
| SMILES | C=C[C@H](CC(F)(F)CO[Si](C)(C)C(C)(C)C)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C21H34F2O2Si/c1-7-18(19(24)14-13-17-11-9-8-10-12-17)15-21(22,23)16-25-26(5,6)20(2,3)4/h7-12,18-19,24H,1,13-16H2,2-6H3/t18-,19-/m1/s1 |
| InChIKey | LZJNYKQQBPDPTF-RTBURBONSA-N |
| XLogP | 5.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|