C23H32O3Si — CID 134960284
(3Z,3aS,7aS)-3-benzylidene-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4-dihydro-1-benzofuran-5-one (PubChem CID 134960284) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (3Z,3aS,7aS)-3-benzylidene-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4-dihydro-1-benzofuran-5-one.
| Compound Name | (3Z,3aS,7aS)-3-benzylidene-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4-dihydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 134960284 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (3Z,3aS,7aS)-3-benzylidene-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3a,4-dihydro-1-benzofuran-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@]12C=CC(=O)C[C@H]1/C(=C/c1ccccc1)CO2 |
| InChI | InChI=1S/C23H32O3Si/c1-22(2,3)27(4,5)26-14-13-23-12-11-20(24)16-21(23)19(17-25-23)15-18-9-7-6-8-10-18/h6-12,15,21H,13-14,16-17H2,1-5H3/b19-15+/t21-,23+/m0/s1 |
| InChIKey | XYLAQLVJLNVMKK-YNLHYXARSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|