C17H28O3Si — CID 134960285
(3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylidene-3a,4-dihydro-1-benzofuran-5-one (PubChem CID 134960285) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is (3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylidene-3a,4-dihydro-1-benzofuran-5-one.
| Compound Name | (3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylidene-3a,4-dihydro-1-benzofuran-5-one |
|---|---|
| PubChem CID | 134960285 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3aS,7aS)-7a-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methylidene-3a,4-dihydro-1-benzofuran-5-one |
| SMILES | C=C1CO[C@@]2(CCO[Si](C)(C)C(C)(C)C)C=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H28O3Si/c1-13-12-19-17(8-7-14(18)11-15(13)17)9-10-20-21(5,6)16(2,3)4/h7-8,15H,1,9-12H2,2-6H3/t15-,17+/m0/s1 |
| InChIKey | NKAQJRCNMGNSET-DOTOQJQBSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|