C24H18F5NO3S — CID 134960381
[(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydroindol-2-yl]-phenylmethanone (PubChem CID 134960381) has the molecular formula C24H18F5NO3S and a molecular weight of 495.47 g/mol. Its IUPAC name is [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydroindol-2-yl]-phenylmethanone.
| Compound Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydroindol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134960381 |
| Molecular Formula | C24H18F5NO3S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | [(2R,3R)-1-(4-methylphenyl)sulfonyl-3-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydroindol-2-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3[C@@H](C(F)(F)C(F)(F)F)[C@@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18F5NO3S/c1-15-11-13-17(14-12-15)34(32,33)30-19-10-6-5-9-18(19)20(23(25,26)24(27,28)29)21(30)22(31)16-7-3-2-4-8-16/h2-14,20-21H,1H3/t20-,21-/m1/s1 |
| InChIKey | FQPHSZUPOBYYFX-NHCUHLMSSA-N |
| XLogP | 5.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|