C18H27NO3 — CID 134960488
tert-butyl (3aS,7aS)-7a-butyl-3-methylidene-5-oxo-3a,4-dihydro-2H-indole-1-carboxylate (PubChem CID 134960488) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl (3aS,7aS)-7a-butyl-3-methylidene-5-oxo-3a,4-dihydro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl (3aS,7aS)-7a-butyl-3-methylidene-5-oxo-3a,4-dihydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 134960488 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl (3aS,7aS)-7a-butyl-3-methylidene-5-oxo-3a,4-dihydro-2H-indole-1-carboxylate |
| SMILES | C=C1CN(C(=O)OC(C)(C)C)[C@@]2(CCCC)C=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C18H27NO3/c1-6-7-9-18-10-8-14(20)11-15(18)13(2)12-19(18)16(21)22-17(3,4)5/h8,10,15H,2,6-7,9,11-12H2,1,3-5H3/t15-,18-/m0/s1 |
| InChIKey | UAGDIPIDRKAKGS-YJBOKZPZSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|