C21H25NO2 — CID 134960498
(1R,2S,6S,10S)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-14,20-dione (PubChem CID 134960498) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R,2S,6S,10S)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-14,20-dione.
| Compound Name | (1R,2S,6S,10S)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-14,20-dione |
|---|---|
| PubChem CID | 134960498 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1R,2S,6S,10S)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-14,20-dione |
| SMILES | C[C@@H]1CN2C[C@H]3CCC4=C5C(=CC[C@@]56C(=O)C1CC2[C@@]36C)CC4=O |
| InChI | InChI=1S/C21H25NO2/c1-11-9-22-10-13-3-4-14-16(23)7-12-5-6-21(18(12)14)19(24)15(11)8-17(22)20(13,21)2/h5,11,13,15,17H,3-4,6-10H2,1-2H3/t11-,13-,15?,17?,20-,21+/m1/s1 |
| InChIKey | RTKGTTXYWLIMFR-TUBIZESNSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |