C20H18ClFN2O2 — CID 134960514
2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]ethanone (PubChem CID 134960514) has the molecular formula C20H18ClFN2O2 and a molecular weight of 372.83 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]ethanone.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]ethanone |
|---|---|
| PubChem CID | 134960514 |
| Molecular Formula | C20H18ClFN2O2 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-1-[1-(oxan-2-yl)indazol-5-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1Cl)c1ccc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C20H18ClFN2O2/c21-17-11-16(22)6-4-13(17)10-19(25)14-5-7-18-15(9-14)12-23-24(18)20-3-1-2-8-26-20/h4-7,9,11-12,20H,1-3,8,10H2 |
| InChIKey | KKMBYFVVUOLSTH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |