C21H25NO2S — CID 134960616
(1R,2S,6S,10S,16S)-2,6-dimethyl-9-sulfanylidene-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-14,20-dione (PubChem CID 134960616) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (1R,2S,6S,10S,16S)-2,6-dimethyl-9-sulfanylidene-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-14,20-dione.
| Compound Name | (1R,2S,6S,10S,16S)-2,6-dimethyl-9-sulfanylidene-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-14,20-dione |
|---|---|
| PubChem CID | 134960616 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (1R,2S,6S,10S,16S)-2,6-dimethyl-9-sulfanylidene-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-14,20-dione |
| SMILES | C[C@@H]1CN2C(=S)[C@H]3CCC4=C5[C@@H](CC[C@@]56C(=O)C1CC2[C@@]36C)CC4=O |
| InChI | InChI=1S/C21H25NO2S/c1-10-9-22-16-8-13(10)18(24)21-6-5-11-7-15(23)12(17(11)21)3-4-14(19(22)25)20(16,21)2/h10-11,13-14,16H,3-9H2,1-2H3/t10-,11+,13?,14-,16?,20-,21+/m1/s1 |
| InChIKey | WETDWZSLYHPRRN-XFZNNYNBSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|