C19H21NO — CID 134960675
(1S)-1-ethenyl-7-[(E)-pent-1-enyl]-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one (PubChem CID 134960675) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (1S)-1-ethenyl-7-[(E)-pent-1-enyl]-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one.
| Compound Name | (1S)-1-ethenyl-7-[(E)-pent-1-enyl]-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one |
|---|---|
| PubChem CID | 134960675 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (1S)-1-ethenyl-7-[(E)-pent-1-enyl]-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one |
| SMILES | C=C[C@@H]1CCc2ccc3cc(/C=C/CCC)c(=O)cc-3n21 |
| InChI | InChI=1S/C19H21NO/c1-3-5-6-7-15-12-14-8-9-17-11-10-16(4-2)20(17)18(14)13-19(15)21/h4,6-9,12-13,16H,2-3,5,10-11H2,1H3/b7-6+/t16-/m1/s1 |
| InChIKey | MSVBRKBTNZXGMS-FYCOFBDGSA-N |
| XLogP | 4.44 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|