C15H19F5O2 — CID 134960944
1-(4,4-diethoxy-1,1-difluorobutyl)-3-(trifluoromethyl)benzene (PubChem CID 134960944) has the molecular formula C15H19F5O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1-(4,4-diethoxy-1,1-difluorobutyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(4,4-diethoxy-1,1-difluorobutyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134960944 |
| Molecular Formula | C15H19F5O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(4,4-diethoxy-1,1-difluorobutyl)-3-(trifluoromethyl)benzene |
| SMILES | CCOC(CCC(F)(F)c1cccc(C(F)(F)F)c1)OCC |
| InChI | InChI=1S/C15H19F5O2/c1-3-21-13(22-4-2)8-9-14(16,17)11-6-5-7-12(10-11)15(18,19)20/h5-7,10,13H,3-4,8-9H2,1-2H3 |
| InChIKey | XPXHNOBQQHNTRB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|