C16H20N2O4 — CID 134961016
tert-butyl N-[(R)-(2,5-dioxopyrrolidin-1-yl)-phenylmethyl]carbamate (PubChem CID 134961016) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl N-[(R)-(2,5-dioxopyrrolidin-1-yl)-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[(R)-(2,5-dioxopyrrolidin-1-yl)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 134961016 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | tert-butyl N-[(R)-(2,5-dioxopyrrolidin-1-yl)-phenylmethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccccc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,3)22-15(21)17-14(11-7-5-4-6-8-11)18-12(19)9-10-13(18)20/h4-8,14H,9-10H2,1-3H3,(H,17,21)/t14-/m1/s1 |
| InChIKey | UGBDJCIPVAWGHK-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|