C23H19N3O — CID 134961035
(15R)-13-benzyl-15-ethenyl-11,13,16-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11-hexaen-17-one (PubChem CID 134961035) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (15R)-13-benzyl-15-ethenyl-11,13,16-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11-hexaen-17-one.
| Compound Name | (15R)-13-benzyl-15-ethenyl-11,13,16-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11-hexaen-17-one |
|---|---|
| PubChem CID | 134961035 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (15R)-13-benzyl-15-ethenyl-11,13,16-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,11-hexaen-17-one |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)c2nc3cc4ccccc4cc3c(=O)n21 |
| InChI | InChI=1S/C23H19N3O/c1-2-19-15-25(14-16-8-4-3-5-9-16)23-24-21-13-18-11-7-6-10-17(18)12-20(21)22(27)26(19)23/h2-13,19H,1,14-15H2/t19-/m1/s1 |
| InChIKey | KLFSQVMLAFUWFY-LJQANCHMSA-N |
| XLogP | 4.30 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|