About 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid
9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid (PubChem CID 134961047) has the molecular formula C36H48O3Si2
and a molecular weight of 584.95 g/mol. Its IUPAC name is 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid.
Molecular Properties
| Compound Name | 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid |
| PubChem CID | 134961047 |
| Molecular Formula | C36H48O3Si2 |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid |
| SMILES | CC(C)[Si](C#Cc1cc2c(c(C#C[Si](C(C)C)(C(C)C)C(C)C)c1C(=O)O)C(=O)c1ccccc1-2)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H48O3Si2/c1-22(2)40(23(3)4,24(5)6)19-17-28-21-32-29-15-13-14-16-30(29)35(37)34(32)31(33(28)36(38)39)18-20-41(25(7)8,26(9)10)27(11)12/h13-16,21-27H,1-12H3,(H,38,39) |
| InChIKey | VOAMDUNHDWSHJT-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid?
The IUPAC name of 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid (CID 134961047) is 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid.
What is the SMILES notation for 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid?
The canonical SMILES for 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid is CC(C)[Si](C#Cc1cc2c(c(C#C[Si](C(C)C)(C(C)C)C(C)C)c1C(=O)O)C(=O)c1ccccc1-2)(C(C)C)C(C)C.
What is the InChIKey of 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid?
The InChIKey is VOAMDUNHDWSHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H48O3Si2/c1-22(2)40(23(3)4,24(5)6)19-17-28-21-32-29-15-13-14-16-30(29)35(37)34(32)31(33(28)36(38)39)18-20-41(25(7)8,26(9)10)27(11)12/h13-16,21-27H,1-12H3,(H,38,39).
What are the key properties of 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid?
9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid has a molecular weight of 584.95 g/mol, XLogP of 9.74, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxo-1,3-bis[2-tri(propan-2-yl)silylethynyl]fluorene-2-carboxylic acid is sourced from PubChem (CID 134961047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).