C19H27NO2Si — CID 134961090
1-[(E,6S)-6-phenyl-6-trimethylsilylhex-4-enyl]pyrrolidine-2,5-dione (PubChem CID 134961090) has the molecular formula C19H27NO2Si and a molecular weight of 329.52 g/mol. Its IUPAC name is 1-[(E,6S)-6-phenyl-6-trimethylsilylhex-4-enyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(E,6S)-6-phenyl-6-trimethylsilylhex-4-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134961090 |
| Molecular Formula | C19H27NO2Si |
| Molecular Weight | 329.52 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 1-[(E,6S)-6-phenyl-6-trimethylsilylhex-4-enyl]pyrrolidine-2,5-dione |
| SMILES | C[Si](C)(C)[C@@H](/C=C/CCCN1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C19H27NO2Si/c1-23(2,3)17(16-10-6-4-7-11-16)12-8-5-9-15-20-18(21)13-14-19(20)22/h4,6-8,10-12,17H,5,9,13-15H2,1-3H3/b12-8+/t17-/m0/s1 |
| InChIKey | FGNYJYNANMMCMR-UEICXMAYSA-N |
| XLogP | 4.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|