C29H37NO5 — CID 134961106
[2-[(3,5-ditert-butyl-4-hydroxyphenyl)-(5-propan-2-yl-1,3-oxazol-4-yl)methyl]phenyl] methyl carbonate (PubChem CID 134961106) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is [2-[(3,5-ditert-butyl-4-hydroxyphenyl)-(5-propan-2-yl-1,3-oxazol-4-yl)methyl]phenyl] methyl carbonate.
| Compound Name | [2-[(3,5-ditert-butyl-4-hydroxyphenyl)-(5-propan-2-yl-1,3-oxazol-4-yl)methyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 134961106 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | [2-[(3,5-ditert-butyl-4-hydroxyphenyl)-(5-propan-2-yl-1,3-oxazol-4-yl)methyl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccccc1C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ncoc1C(C)C |
| InChI | InChI=1S/C29H37NO5/c1-17(2)26-24(30-16-34-26)23(19-12-10-11-13-22(19)35-27(32)33-9)18-14-20(28(3,4)5)25(31)21(15-18)29(6,7)8/h10-17,23,31H,1-9H3 |
| InChIKey | RXDGTCFREBBQQH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|