C13H18O3Si — CID 134961113
(1R,2S,5R)-2-methoxy-6-(2-trimethylsilylethynyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 134961113) has the molecular formula C13H18O3Si and a molecular weight of 250.37 g/mol. Its IUPAC name is (1R,2S,5R)-2-methoxy-6-(2-trimethylsilylethynyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5R)-2-methoxy-6-(2-trimethylsilylethynyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 134961113 |
| Molecular Formula | C13H18O3Si |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1R,2S,5R)-2-methoxy-6-(2-trimethylsilylethynyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CO[C@@H]1C(=O)C[C@H]2O[C@@H]1C=C2C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H18O3Si/c1-15-13-10(14)8-11-9(7-12(13)16-11)5-6-17(2,3)4/h7,11-13H,8H2,1-4H3/t11-,12-,13-/m1/s1 |
| InChIKey | YXNDETFPCQLAFK-JHJVBQTASA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|