C20H28O3 — CID 134961119
(1R,2S,5S,9S,12R,13S,16S)-1,5-dimethyl-13-propan-2-yl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-ene-10,15-dione (PubChem CID 134961119) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2S,5S,9S,12R,13S,16S)-1,5-dimethyl-13-propan-2-yl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-ene-10,15-dione.
| Compound Name | (1R,2S,5S,9S,12R,13S,16S)-1,5-dimethyl-13-propan-2-yl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-ene-10,15-dione |
|---|---|
| PubChem CID | 134961119 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2S,5S,9S,12R,13S,16S)-1,5-dimethyl-13-propan-2-yl-11-oxatetracyclo[7.6.1.02,7.012,16]hexadec-7-ene-10,15-dione |
| SMILES | CC(C)[C@@H]1CC(=O)[C@@]2(C)[C@H]3[C@@H]1OC(=O)[C@H]3C=C1C[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H28O3/c1-10(2)13-9-16(21)20(4)15-6-5-11(3)7-12(15)8-14-17(20)18(13)23-19(14)22/h8,10-11,13-15,17-18H,5-7,9H2,1-4H3/t11-,13-,14-,15-,17+,18+,20-/m0/s1 |
| InChIKey | GQNFIWJHVSUEGH-PEIWBPOXSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|