About ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate
ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate (PubChem CID 134961145) has the molecular formula C25H23F3N2O2
and a molecular weight of 440.47 g/mol. Its IUPAC name is ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate |
| PubChem CID | 134961145 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@H]2CCC[C@@H]2c2cnc(-c3ccc(C(F)(F)F)cc3)nc2)cc1 |
| InChI | InChI=1S/C25H23F3N2O2/c1-2-32-24(31)18-8-6-16(7-9-18)21-4-3-5-22(21)19-14-29-23(30-15-19)17-10-12-20(13-11-17)25(26,27)28/h6-15,21-22H,2-5H2,1H3/t21-,22-/m1/s1 |
| InChIKey | GTOPYXXQCJRABW-FGZHOGPDSA-N |
| XLogP | 6.39 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate?
The IUPAC name of ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate (CID 134961145) is ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate.
What is the SMILES notation for ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate?
The canonical SMILES for ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate is CCOC(=O)c1ccc([C@H]2CCC[C@@H]2c2cnc(-c3ccc(C(F)(F)F)cc3)nc2)cc1.
What is the InChIKey of ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate?
The InChIKey is GTOPYXXQCJRABW-FGZHOGPDSA-N. The full InChI is InChI=1S/C25H23F3N2O2/c1-2-32-24(31)18-8-6-16(7-9-18)21-4-3-5-22(21)19-14-29-23(30-15-19)17-10-12-20(13-11-17)25(26,27)28/h6-15,21-22H,2-5H2,1H3/t21-,22-/m1/s1.
What are the key properties of ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate?
ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate has a molecular weight of 440.47 g/mol, XLogP of 6.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1S,2S)-2-[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]cyclopentyl]benzoate is sourced from PubChem (CID 134961145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).