C20H26O6 — CID 134961158
(3S)-3-phenyl-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanal (PubChem CID 134961158) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (3S)-3-phenyl-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanal.
| Compound Name | (3S)-3-phenyl-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanal |
|---|---|
| PubChem CID | 134961158 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S)-3-phenyl-3-[(1S,2R,6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanal |
| SMILES | CC1(C)O[C@H]2OC([C@@H](CC=O)c3ccccc3)[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C20H26O6/c1-19(2)23-15-14(13(10-11-21)12-8-6-5-7-9-12)22-18-17(16(15)24-19)25-20(3,4)26-18/h5-9,11,13-18H,10H2,1-4H3/t13-,14?,15-,16-,17+,18+/m0/s1 |
| InChIKey | BUTLGAQPGHMHSK-AZIQFTTNSA-N |
| XLogP | 2.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|