C22H32O4 — CID 134961193
2-[(1S,2R,5R,10S,14R)-11,11,16,16-tetramethyl-9-oxo-15,17-dioxatetracyclo[8.8.0.01,14.02,7]octadec-7-en-5-yl]acetaldehyde (PubChem CID 134961193) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[(1S,2R,5R,10S,14R)-11,11,16,16-tetramethyl-9-oxo-15,17-dioxatetracyclo[8.8.0.01,14.02,7]octadec-7-en-5-yl]acetaldehyde.
| Compound Name | 2-[(1S,2R,5R,10S,14R)-11,11,16,16-tetramethyl-9-oxo-15,17-dioxatetracyclo[8.8.0.01,14.02,7]octadec-7-en-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 134961193 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[(1S,2R,5R,10S,14R)-11,11,16,16-tetramethyl-9-oxo-15,17-dioxatetracyclo[8.8.0.01,14.02,7]octadec-7-en-5-yl]acetaldehyde |
| SMILES | CC1(C)OC[C@]23[C@@H]4CC[C@@H](CC=O)CC4=CC(=O)[C@H]2C(C)(C)CC[C@H]3O1 |
| InChI | InChI=1S/C22H32O4/c1-20(2)9-7-18-22(13-25-21(3,4)26-18)16-6-5-14(8-10-23)11-15(16)12-17(24)19(20)22/h10,12,14,16,18-19H,5-9,11,13H2,1-4H3/t14-,16+,18+,19-,22+/m0/s1 |
| InChIKey | LXKQNHUQOJOWGF-VRUXIHJPSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|