About [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol
[(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol (PubChem CID 134961197) has the molecular formula C19H21ClFNO2
and a molecular weight of 349.83 g/mol. Its IUPAC name is [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol.
Molecular Properties
| Compound Name | [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol |
| PubChem CID | 134961197 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol |
| SMILES | OC[C@@H]1CN(Cc2ccccc2)CCO[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H21ClFNO2/c20-17-7-6-15(10-18(17)21)19-16(13-23)12-22(8-9-24-19)11-14-4-2-1-3-5-14/h1-7,10,16,19,23H,8-9,11-13H2/t16-,19-/m0/s1 |
| InChIKey | VNNGTQWCWBMSLP-LPHOPBHVSA-N |
| XLogP | 3.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The IUPAC name of [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol (CID 134961197) is [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol.
What is the SMILES notation for [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The canonical SMILES for [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol is OC[C@@H]1CN(Cc2ccccc2)CCO[C@H]1c1ccc(Cl)c(F)c1.
What is the InChIKey of [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The InChIKey is VNNGTQWCWBMSLP-LPHOPBHVSA-N. The full InChI is InChI=1S/C19H21ClFNO2/c20-17-7-6-15(10-18(17)21)19-16(13-23)12-22(8-9-24-19)11-14-4-2-1-3-5-14/h1-7,10,16,19,23H,8-9,11-13H2/t16-,19-/m0/s1.
What are the key properties of [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
[(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol has a molecular weight of 349.83 g/mol, XLogP of 3.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6S,7R)-4-benzyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methanol is sourced from PubChem (CID 134961197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).