C22H32O4 — CID 134961558
5-(6,7-dimethyl-1-oxo-3,4,5,6-tetrahydro-2H-inden-3a-yl)-3-ethenyl-4-(methoxymethoxy)-3-methylhex-5-enal (PubChem CID 134961558) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 5-(6,7-dimethyl-1-oxo-3,4,5,6-tetrahydro-2H-inden-3a-yl)-3-ethenyl-4-(methoxymethoxy)-3-methylhex-5-enal.
| Compound Name | 5-(6,7-dimethyl-1-oxo-3,4,5,6-tetrahydro-2H-inden-3a-yl)-3-ethenyl-4-(methoxymethoxy)-3-methylhex-5-enal |
|---|---|
| PubChem CID | 134961558 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 5-(6,7-dimethyl-1-oxo-3,4,5,6-tetrahydro-2H-inden-3a-yl)-3-ethenyl-4-(methoxymethoxy)-3-methylhex-5-enal |
| SMILES | C=CC(C)(CC=O)C(OCOC)C(=C)C12CCC(=O)C1=C(C)C(C)CC2 |
| InChI | InChI=1S/C22H32O4/c1-7-21(5,12-13-23)20(26-14-25-6)17(4)22-10-8-15(2)16(3)19(22)18(24)9-11-22/h7,13,15,20H,1,4,8-12,14H2,2-3,5-6H3 |
| InChIKey | RNEYWGVDEBNUQU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|