About trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one
trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one (PubChem CID 134961564) has the molecular formula C25H21FO3
and a molecular weight of 388.44 g/mol. Its IUPAC name is trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one |
| PubChem CID | 134961564 |
| Molecular Formula | C25H21FO3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one |
| SMILES | O=C(c1ccccc1)c1ccccc1C[C@]1(O)CCC(=O)[C@@]1(F)c1ccccc1 |
| InChI | InChI=1S/C25H21FO3/c26-25(20-12-5-2-6-13-20)22(27)15-16-24(25,29)17-19-11-7-8-14-21(19)23(28)18-9-3-1-4-10-18/h1-14,29H,15-17H2/t24-,25+/m1/s1 |
| InChIKey | QRRSGJSJGJUMGE-RPBOFIJWSA-N |
| XLogP | 4.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one?
The IUPAC name of trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one (CID 134961564) is trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one.
What is the SMILES notation for trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one?
The canonical SMILES for trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one is O=C(c1ccccc1)c1ccccc1C[C@]1(O)CCC(=O)[C@@]1(F)c1ccccc1.
What is the InChIKey of trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one?
The InChIKey is QRRSGJSJGJUMGE-RPBOFIJWSA-N. The full InChI is InChI=1S/C25H21FO3/c26-25(20-12-5-2-6-13-20)22(27)15-16-24(25,29)17-19-11-7-8-14-21(19)23(28)18-9-3-1-4-10-18/h1-14,29H,15-17H2/t24-,25+/m1/s1.
What are the key properties of trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one?
trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one has a molecular weight of 388.44 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,3R)-3-[(2-benzoylphenyl)methyl]-2-fluoro-3-hydroxy-2-phenylcyclopentan-1-one is sourced from PubChem (CID 134961564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).