C18H20BrNO2 — CID 134961710
3-(4-bromophenyl)-N-(3-hydroxypropyl)-2-phenylpropanamide (PubChem CID 134961710) has the molecular formula C18H20BrNO2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(3-hydroxypropyl)-2-phenylpropanamide.
| Compound Name | 3-(4-bromophenyl)-N-(3-hydroxypropyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 134961710 |
| Molecular Formula | C18H20BrNO2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-(4-bromophenyl)-N-(3-hydroxypropyl)-2-phenylpropanamide |
| SMILES | O=C(NCCCO)C(Cc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20BrNO2/c19-16-9-7-14(8-10-16)13-17(15-5-2-1-3-6-15)18(22)20-11-4-12-21/h1-3,5-10,17,21H,4,11-13H2,(H,20,22) |
| InChIKey | JHLUHCMRZXNQPC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|