C19H30O3 — CID 134961744
methyl 2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-yl]acetate (PubChem CID 134961744) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is methyl 2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-yl]acetate.
| Compound Name | methyl 2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-yl]acetate |
|---|---|
| PubChem CID | 134961744 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | methyl 2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-yl]acetate |
| SMILES | C=CC1C2C(CC)C[C@@]3(CC)OC(CC(=O)OC)[C@]1(CC)C23 |
| InChI | InChI=1S/C19H30O3/c1-6-12-11-18(8-3)17-16(12)13(7-2)19(17,9-4)14(22-18)10-15(20)21-5/h7,12-14,16-17H,2,6,8-11H2,1,3-5H3/t12?,13?,14?,16?,17?,18-,19-/m1/s1 |
| InChIKey | KSBSKJMRSZJJFF-AQJPVJBPSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|