C31H54O4Si — CID 134961752
(2R)-4-ethenyl-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-tri(propan-2-yl)silyloxytricyclo[5.4.3.01,8]tetradec-8-en-6-one (PubChem CID 134961752) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is (2R)-4-ethenyl-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-tri(propan-2-yl)silyloxytricyclo[5.4.3.01,8]tetradec-8-en-6-one.
| Compound Name | (2R)-4-ethenyl-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-tri(propan-2-yl)silyloxytricyclo[5.4.3.01,8]tetradec-8-en-6-one |
|---|---|
| PubChem CID | 134961752 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | (2R)-4-ethenyl-3-(methoxymethoxy)-2,4,7,14-tetramethyl-9-tri(propan-2-yl)silyloxytricyclo[5.4.3.01,8]tetradec-8-en-6-one |
| SMILES | C=CC1(C)CC(=O)C2(C)C3=C(O[Si](C(C)C)(C(C)C)C(C)C)CCC3(CCC2C)[C@@H](C)C1OCOC |
| InChI | InChI=1S/C31H54O4Si/c1-13-29(10)18-26(32)30(11)23(8)14-16-31(24(9)28(29)34-19-33-12)17-15-25(27(30)31)35-36(20(2)3,21(4)5)22(6)7/h13,20-24,28H,1,14-19H2,2-12H3/t23?,24-,28?,29?,30?,31?/m0/s1 |
| InChIKey | JTIZPOZHBVUVLM-ZDHMSNIXSA-N |
| XLogP | 8.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|