C16H11F3O2S — CID 134961857
2-[3-(trifluoromethoxy)phenyl]-2,3-dihydrothiochromen-4-one (PubChem CID 134961857) has the molecular formula C16H11F3O2S and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]-2,3-dihydrothiochromen-4-one.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]-2,3-dihydrothiochromen-4-one |
|---|---|
| PubChem CID | 134961857 |
| Molecular Formula | C16H11F3O2S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]-2,3-dihydrothiochromen-4-one |
| SMILES | O=C1CC(c2cccc(OC(F)(F)F)c2)Sc2ccccc21 |
| InChI | InChI=1S/C16H11F3O2S/c17-16(18,19)21-11-5-3-4-10(8-11)15-9-13(20)12-6-1-2-7-14(12)22-15/h1-8,15H,9H2 |
| InChIKey | OGMXLXXGXNMEHP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |