C33H36FNO6 — CID 134961869
ethyl (6R,7S)-9-acetyloxy-6-(2-acetyloxy-3-methylbut-2-enyl)-7-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydrocyclohepta[b]indole-5-carboxylate (PubChem CID 134961869) has the molecular formula C33H36FNO6 and a molecular weight of 561.65 g/mol. Its IUPAC name is ethyl (6R,7S)-9-acetyloxy-6-(2-acetyloxy-3-methylbut-2-enyl)-7-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydrocyclohepta[b]indole-5-carboxylate.
| Compound Name | ethyl (6R,7S)-9-acetyloxy-6-(2-acetyloxy-3-methylbut-2-enyl)-7-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydrocyclohepta[b]indole-5-carboxylate |
|---|---|
| PubChem CID | 134961869 |
| Molecular Formula | C33H36FNO6 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | ethyl (6R,7S)-9-acetyloxy-6-(2-acetyloxy-3-methylbut-2-enyl)-7-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydrocyclohepta[b]indole-5-carboxylate |
| SMILES | CCOC(=O)n1c2c(c3ccccc31)C=C(OC(C)=O)C(C)(C)[C@H](c1ccc(F)cc1)[C@H]2CC(OC(C)=O)=C(C)C |
| InChI | InChI=1S/C33H36FNO6/c1-8-39-32(38)35-27-12-10-9-11-24(27)25-18-29(41-21(5)37)33(6,7)30(22-13-15-23(34)16-14-22)26(31(25)35)17-28(19(2)3)40-20(4)36/h9-16,18,26,30H,8,17H2,1-7H3/t26-,30-/m1/s1 |
| InChIKey | DKCXBPILHQNZGG-PDDLMNHVSA-N |
| XLogP | 7.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|