About 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole
1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole (PubChem CID 134961951) has the molecular formula C23H21NS
and a molecular weight of 343.50 g/mol. Its IUPAC name is 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole.
Molecular Properties
| Compound Name | 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole |
| PubChem CID | 134961951 |
| Molecular Formula | C23H21NS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole |
| SMILES | C[C@@H](/C=C/c1ccsc1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H21NS/c1-18(11-12-20-13-14-25-17-20)22-16-24(15-19-7-3-2-4-8-19)23-10-6-5-9-21(22)23/h2-14,16-18H,15H2,1H3/b12-11+/t18-/m0/s1 |
| InChIKey | CJLCMLVEMYNWKC-DXRVJIQQSA-N |
| XLogP | 6.57 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole?
The IUPAC name of 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole (CID 134961951) is 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole.
What is the SMILES notation for 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole?
The canonical SMILES for 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole is C[C@@H](/C=C/c1ccsc1)c1cn(Cc2ccccc2)c2ccccc12.
What is the InChIKey of 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole?
The InChIKey is CJLCMLVEMYNWKC-DXRVJIQQSA-N. The full InChI is InChI=1S/C23H21NS/c1-18(11-12-20-13-14-25-17-20)22-16-24(15-19-7-3-2-4-8-19)23-10-6-5-9-21(22)23/h2-14,16-18H,15H2,1H3/b12-11+/t18-/m0/s1.
What are the key properties of 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole?
1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole has a molecular weight of 343.50 g/mol, XLogP of 6.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(E,2S)-4-thiophen-3-ylbut-3-en-2-yl]indole is sourced from PubChem (CID 134961951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).