About tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate
tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 134961955) has the molecular formula C16H23NO6
and a molecular weight of 325.36 g/mol. Its IUPAC name is tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| PubChem CID | 134961955 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CCOC(=O)C(=O)CC(=O)C1[C@H]2CN(C(=O)OC(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C16H23NO6/c1-5-22-14(20)12(19)6-11(18)13-9-7-17(8-10(9)13)15(21)23-16(2,3)4/h9-10,13H,5-8H2,1-4H3/t9-,10+,13? |
| InChIKey | OOKBIJSANMEZPA-HWYHXSKPSA-N |
| XLogP | 1.19 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The IUPAC name of tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (CID 134961955) is tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
What is the SMILES notation for tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The canonical SMILES for tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is CCOC(=O)C(=O)CC(=O)C1[C@H]2CN(C(=O)OC(C)(C)C)C[C@@H]12.
What is the InChIKey of tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
The InChIKey is OOKBIJSANMEZPA-HWYHXSKPSA-N. The full InChI is InChI=1S/C16H23NO6/c1-5-22-14(20)12(19)6-11(18)13-9-7-17(8-10(9)13)15(21)23-16(2,3)4/h9-10,13H,5-8H2,1-4H3/t9-,10+,13?.
What are the key properties of tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate?
tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate has a molecular weight of 325.36 g/mol, XLogP of 1.19, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1R,5S)-6-(4-ethoxy-3,4-dioxobutanoyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is sourced from PubChem (CID 134961955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).