About benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate
benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 134961963) has the molecular formula C26H21NO2
and a molecular weight of 379.46 g/mol. Its IUPAC name is benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate.
Molecular Properties
| Compound Name | benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate |
| PubChem CID | 134961963 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1nc2ccccc2c2c1C[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C26H21NO2/c28-26(29-17-18-9-3-1-4-10-18)25-23-16-20(19-11-5-2-6-12-19)15-22(23)21-13-7-8-14-24(21)27-25/h1-14,20H,15-17H2/t20-/m1/s1 |
| InChIKey | QNYDFUAFMIBAHT-HXUWFJFHSA-N |
| XLogP | 5.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The IUPAC name of benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate (CID 134961963) is benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate.
What is the SMILES notation for benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The canonical SMILES for benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate is O=C(OCc1ccccc1)c1nc2ccccc2c2c1C[C@H](c1ccccc1)C2.
What is the InChIKey of benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The InChIKey is QNYDFUAFMIBAHT-HXUWFJFHSA-N. The full InChI is InChI=1S/C26H21NO2/c28-26(29-17-18-9-3-1-4-10-18)25-23-16-20(19-11-5-2-6-12-19)15-22(23)21-13-7-8-14-24(21)27-25/h1-14,20H,15-17H2/t20-/m1/s1.
What are the key properties of benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate has a molecular weight of 379.46 g/mol, XLogP of 5.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2R)-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate is sourced from PubChem (CID 134961963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).