About ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate
ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 134961965) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate |
| PubChem CID | 134961965 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2c2c1[C@H](C)[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C22H21NO2/c1-3-25-22(24)21-20-14(2)17(15-9-5-4-6-10-15)13-18(20)16-11-7-8-12-19(16)23-21/h4-12,14,17H,3,13H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | IHHBGGVOLODJJG-RHSMWYFYSA-N |
| XLogP | 4.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The IUPAC name of ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate (CID 134961965) is ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate.
What is the SMILES notation for ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The canonical SMILES for ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate is CCOC(=O)c1nc2ccccc2c2c1[C@H](C)[C@H](c1ccccc1)C2.
What is the InChIKey of ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
The InChIKey is IHHBGGVOLODJJG-RHSMWYFYSA-N. The full InChI is InChI=1S/C22H21NO2/c1-3-25-22(24)21-20-14(2)17(15-9-5-4-6-10-15)13-18(20)16-11-7-8-12-19(16)23-21/h4-12,14,17H,3,13H2,1-2H3/t14-,17-/m1/s1.
What are the key properties of ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate?
ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate has a molecular weight of 331.42 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R,3R)-3-methyl-2-phenyl-2,3-dihydro-1H-cyclopenta[c]quinoline-4-carboxylate is sourced from PubChem (CID 134961965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).