C9H13N4O- — CID 134961990
6-cyclopenta-1,3-dien-1-yl-2,4-dimethyl-1,2,4,5-tetrazinan-3-one (PubChem CID 134961990) has the molecular formula C9H13N4O- and a molecular weight of 193.23 g/mol. Its IUPAC name is 6-cyclopenta-1,3-dien-1-yl-2,4-dimethyl-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-cyclopenta-1,3-dien-1-yl-2,4-dimethyl-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 134961990 |
| Molecular Formula | C9H13N4O- |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6-cyclopenta-1,3-dien-1-yl-2,4-dimethyl-1,2,4,5-tetrazinan-3-one |
| SMILES | CN1NC(c2ccc[cH-]2)NN(C)C1=O |
| InChI | InChI=1S/C9H13N4O/c1-12-9(14)13(2)11-8(10-12)7-5-3-4-6-7/h3-6,8,10-11H,1-2H3/q-1 |
| InChIKey | DGEFVRYLTLUELJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|