C18H22O2 — CID 134962109
(2S,3aS)-2-(4-methoxyphenoxy)-3a-prop-2-enyl-2,3,4,5-tetrahydro-1H-pentalene (PubChem CID 134962109) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2S,3aS)-2-(4-methoxyphenoxy)-3a-prop-2-enyl-2,3,4,5-tetrahydro-1H-pentalene.
| Compound Name | (2S,3aS)-2-(4-methoxyphenoxy)-3a-prop-2-enyl-2,3,4,5-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 134962109 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2S,3aS)-2-(4-methoxyphenoxy)-3a-prop-2-enyl-2,3,4,5-tetrahydro-1H-pentalene |
| SMILES | C=CC[C@]12CCC=C1C[C@@H](Oc1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C18H22O2/c1-3-10-18-11-4-5-14(18)12-17(13-18)20-16-8-6-15(19-2)7-9-16/h3,5-9,17H,1,4,10-13H2,2H3/t17-,18-/m1/s1 |
| InChIKey | YMSDLKZEOWWRSM-QZTJIDSGSA-N |
| XLogP | 4.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|