About 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one
3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one (PubChem CID 134962125) has the molecular formula C19H25NO
and a molecular weight of 283.41 g/mol. Its IUPAC name is 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one |
| PubChem CID | 134962125 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one |
| SMILES | CC(C)(C1CCCC(=O)C1)C1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C19H25NO/c1-19(2,15-9-6-10-16(21)13-15)18-12-11-17(20-18)14-7-4-3-5-8-14/h3-5,7-8,15,18H,6,9-13H2,1-2H3 |
| InChIKey | KFWRLDPXFKCKHL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one?
The IUPAC name of 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one (CID 134962125) is 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one.
What is the SMILES notation for 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one?
The canonical SMILES for 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one is CC(C)(C1CCCC(=O)C1)C1CCC(c2ccccc2)=N1.
What is the InChIKey of 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one?
The InChIKey is KFWRLDPXFKCKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO/c1-19(2,15-9-6-10-16(21)13-15)18-12-11-17(20-18)14-7-4-3-5-8-14/h3-5,7-8,15,18H,6,9-13H2,1-2H3.
What are the key properties of 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one?
3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one has a molecular weight of 283.41 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(5-phenyl-3,4-dihydro-2H-pyrrol-2-yl)propan-2-yl]cyclohexan-1-one is sourced from PubChem (CID 134962125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).